Details for 4-[2-(Nitrophenyl)ethenyl]phenol

4-[2-(Nitrophenyl)ethenyl]phenol
| Category: |
Organic chemicals and Derivatives |
|
| CAS NO: |
14064-83-6 |
| EC NO: |
|
| Molecular Formula: |
C14H11NO3 |
| Molecular Weight: |
241.242 |
| Specification: |
|
| InChI: |
InChI=1/C14H11NO3/c16-14-9-5-12(6-10-14)2-1-11-3-7-13(8-4-11)15(17)18/h1-10,16H/b2-1+ |
| Synonyms: |
4-[2-(Nitrophenyl)ethenyl]phenol;4-[2-(4-nitrophenyl)ethenyl]phenol;4-[(E)-2-(4-nitrophenyl)ethenyl]phenol; |
| Molecular Structure: |
![4-[2-(Nitrophenyl)ethenyl]phenol 14064-83-6](https://images-a.chemnet.com/suppliers/chembase/cas3/cas14064-83-6.gif) |
if you are sourcing 4-[2-(Nitrophenyl)ethenyl]phenol from United-States ,just feel free to inquire